C13H27Cl2N3O2 — CID 119854359
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2-(2-methoxyethylamino)acetamide;dihydrochloride (PubChem CID 119854359) has the molecular formula C13H27Cl2N3O2 and a molecular weight of 328.28 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2-(2-methoxyethylamino)acetamide;dihydrochloride.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2-(2-methoxyethylamino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119854359 |
| Molecular Formula | C13H27Cl2N3O2 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2-(2-methoxyethylamino)acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)NC1CCN2CCCC2C1.Cl.Cl |
| InChI | InChI=1S/C13H25N3O2.2ClH/c1-18-8-5-14-10-13(17)15-11-4-7-16-6-2-3-12(16)9-11;;/h11-12,14H,2-10H2,1H3,(H,15,17);2*1H |
| InChIKey | NRCOOOMFIZLXOT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|