C15H28N4O2 — CID 82964536
(2S)-2-amino-N-[2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-2-oxoethyl]-3-methylbutanamide (PubChem CID 82964536) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-2-oxoethyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 82964536 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (2S)-2-amino-N-[2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-2-oxoethyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)NC1CCN2CCCC2C1 |
| InChI | InChI=1S/C15H28N4O2/c1-10(2)14(16)15(21)17-9-13(20)18-11-5-7-19-6-3-4-12(19)8-11/h10-12,14H,3-9,16H2,1-2H3,(H,17,21)(H,18,20)/t11?,12?,14-/m0/s1 |
| InChIKey | LHHYPMLCHVAIAG-YIZWMMSDSA-N |
| XLogP | -0.17 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |