C11H21N3O2S — CID 113345692
(2S)-2-amino-3-methyl-N-[2-oxo-2-(thiolan-3-ylamino)ethyl]butanamide (PubChem CID 113345692) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[2-oxo-2-(thiolan-3-ylamino)ethyl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[2-oxo-2-(thiolan-3-ylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 113345692 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[2-oxo-2-(thiolan-3-ylamino)ethyl]butanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)NC1CCSC1 |
| InChI | InChI=1S/C11H21N3O2S/c1-7(2)10(12)11(16)13-5-9(15)14-8-3-4-17-6-8/h7-8,10H,3-6,12H2,1-2H3,(H,13,16)(H,14,15)/t8?,10-/m0/s1 |
| InChIKey | AMHUYSYKSKRMAE-HTLJXXAVSA-N |
| XLogP | -0.29 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |