C14H26N4O2 — CID 82962152
(2S)-2-amino-N-[2-(1-azabicyclo[2.2.2]octan-3-ylamino)-2-oxoethyl]-3-methylbutanamide (PubChem CID 82962152) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(1-azabicyclo[2.2.2]octan-3-ylamino)-2-oxoethyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(1-azabicyclo[2.2.2]octan-3-ylamino)-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 82962152 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (2S)-2-amino-N-[2-(1-azabicyclo[2.2.2]octan-3-ylamino)-2-oxoethyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)NC1CN2CCC1CC2 |
| InChI | InChI=1S/C14H26N4O2/c1-9(2)13(15)14(20)16-7-12(19)17-11-8-18-5-3-10(11)4-6-18/h9-11,13H,3-8,15H2,1-2H3,(H,16,20)(H,17,19)/t11?,13-/m0/s1 |
| InChIKey | ZZLYDYCLFQKVLX-YUZLPWPTSA-N |
| XLogP | -0.70 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |