C16H29N3O2 — CID 82963322
(2S)-N-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2-amino-3-methylbutanamide (PubChem CID 82963322) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is (2S)-N-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2-amino-3-methylbutanamide.
| Compound Name | (2S)-N-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2-amino-3-methylbutanamide |
|---|---|
| PubChem CID | 82963322 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | (2S)-N-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2-amino-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H29N3O2/c1-11(2)15(17)16(21)18-9-14(20)19-8-7-12-5-3-4-6-13(12)10-19/h11-13,15H,3-10,17H2,1-2H3,(H,18,21)/t12?,13?,15-/m0/s1 |
| InChIKey | TXCPSDKTCXDYTH-PIMMBPRGSA-N |
| XLogP | 1.12 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |