C8H14N2O3S — CID 103063031
3-amino-4-oxo-4-(thiolan-3-ylamino)butanoic acid (PubChem CID 103063031) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-amino-4-oxo-4-(thiolan-3-ylamino)butanoic acid.
| Compound Name | 3-amino-4-oxo-4-(thiolan-3-ylamino)butanoic acid |
|---|---|
| PubChem CID | 103063031 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 3-amino-4-oxo-4-(thiolan-3-ylamino)butanoic acid |
| SMILES | NC(CC(=O)O)C(=O)NC1CCSC1 |
| InChI | InChI=1S/C8H14N2O3S/c9-6(3-7(11)12)8(13)10-5-1-2-14-4-5/h5-6H,1-4,9H2,(H,10,13)(H,11,12) |
| InChIKey | UKJIBZZMZXVFHK-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |