C12H24N2OS — CID 107472858
2-(aminomethyl)-4,4-dimethyl-N-(thiolan-3-yl)pentanamide (PubChem CID 107472858) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is 2-(aminomethyl)-4,4-dimethyl-N-(thiolan-3-yl)pentanamide.
| Compound Name | 2-(aminomethyl)-4,4-dimethyl-N-(thiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 107472858 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-(aminomethyl)-4,4-dimethyl-N-(thiolan-3-yl)pentanamide |
| SMILES | CC(C)(C)CC(CN)C(=O)NC1CCSC1 |
| InChI | InChI=1S/C12H24N2OS/c1-12(2,3)6-9(7-13)11(15)14-10-4-5-16-8-10/h9-10H,4-8,13H2,1-3H3,(H,14,15) |
| InChIKey | UBQSHYZFWWOOFH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |