C12H24N2OS — CID 103063106
6-amino-4,4-dimethyl-N-(thiolan-3-yl)hexanamide (PubChem CID 103063106) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is 6-amino-4,4-dimethyl-N-(thiolan-3-yl)hexanamide.
| Compound Name | 6-amino-4,4-dimethyl-N-(thiolan-3-yl)hexanamide |
|---|---|
| PubChem CID | 103063106 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 6-amino-4,4-dimethyl-N-(thiolan-3-yl)hexanamide |
| SMILES | CC(C)(CCN)CCC(=O)NC1CCSC1 |
| InChI | InChI=1S/C12H24N2OS/c1-12(2,6-7-13)5-3-11(15)14-10-4-8-16-9-10/h10H,3-9,13H2,1-2H3,(H,14,15) |
| InChIKey | KFKHMNJGGXXGQC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |