C16H32N2O — CID 65291109
6-amino-N-(3,5-dimethylcyclohexyl)-4,4-dimethylhexanamide (PubChem CID 65291109) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 6-amino-N-(3,5-dimethylcyclohexyl)-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-(3,5-dimethylcyclohexyl)-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 65291109 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 6-amino-N-(3,5-dimethylcyclohexyl)-4,4-dimethylhexanamide |
| SMILES | CC1CC(C)CC(NC(=O)CCC(C)(C)CCN)C1 |
| InChI | InChI=1S/C16H32N2O/c1-12-9-13(2)11-14(10-12)18-15(19)5-6-16(3,4)7-8-17/h12-14H,5-11,17H2,1-4H3,(H,18,19) |
| InChIKey | WHZQOWHILFOEFE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |