C10H18BrNO — CID 64733863
2-bromo-N-(3,5-dimethylcyclohexyl)acetamide (PubChem CID 64733863) has the molecular formula C10H18BrNO and a molecular weight of 248.16 g/mol. Its IUPAC name is 2-bromo-N-(3,5-dimethylcyclohexyl)acetamide.
| Compound Name | 2-bromo-N-(3,5-dimethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 64733863 |
| Molecular Formula | C10H18BrNO |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-bromo-N-(3,5-dimethylcyclohexyl)acetamide |
| SMILES | CC1CC(C)CC(NC(=O)CBr)C1 |
| InChI | InChI=1S/C10H18BrNO/c1-7-3-8(2)5-9(4-7)12-10(13)6-11/h7-9H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | AJINDNMTRQLABZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|