C16H23NOS — CID 107030984
N-(3,5-dimethylcyclohexyl)-2-(4-sulfanylphenyl)acetamide (PubChem CID 107030984) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-2-(4-sulfanylphenyl)acetamide.
| Compound Name | N-(3,5-dimethylcyclohexyl)-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 107030984 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-2-(4-sulfanylphenyl)acetamide |
| SMILES | CC1CC(C)CC(NC(=O)Cc2ccc(S)cc2)C1 |
| InChI | InChI=1S/C16H23NOS/c1-11-7-12(2)9-14(8-11)17-16(18)10-13-3-5-15(19)6-4-13/h3-6,11-12,14,19H,7-10H2,1-2H3,(H,17,18) |
| InChIKey | VAUHPRWLQCGUNY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|