C17H25NOS — CID 107030989
N-(3,5-dimethylcyclohexyl)-3-phenyl-2-sulfanylpropanamide (PubChem CID 107030989) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-3-phenyl-2-sulfanylpropanamide.
| Compound Name | N-(3,5-dimethylcyclohexyl)-3-phenyl-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107030989 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-3-phenyl-2-sulfanylpropanamide |
| SMILES | CC1CC(C)CC(NC(=O)C(S)Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H25NOS/c1-12-8-13(2)10-15(9-12)18-17(19)16(20)11-14-6-4-3-5-7-14/h3-7,12-13,15-16,20H,8-11H2,1-2H3,(H,18,19) |
| InChIKey | DXULDMAQOKOJPJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|