C12H17NO3S — CID 107031176
N-(1,3-dihydroxypropan-2-yl)-3-phenyl-2-sulfanylpropanamide (PubChem CID 107031176) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-3-phenyl-2-sulfanylpropanamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-3-phenyl-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107031176 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-3-phenyl-2-sulfanylpropanamide |
| SMILES | O=C(NC(CO)CO)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO3S/c14-7-10(8-15)13-12(16)11(17)6-9-4-2-1-3-5-9/h1-5,10-11,14-15,17H,6-8H2,(H,13,16) |
| InChIKey | OZTILEYYWRXRHL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|