C26H27N3O3S — CID 18348141
N,N'-dibenzyl-2-[(3-phenyl-2-sulfanylpropanoyl)amino]propanediamide (PubChem CID 18348141) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is N,N'-dibenzyl-2-[(3-phenyl-2-sulfanylpropanoyl)amino]propanediamide.
| Compound Name | N,N'-dibenzyl-2-[(3-phenyl-2-sulfanylpropanoyl)amino]propanediamide |
|---|---|
| PubChem CID | 18348141 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N,N'-dibenzyl-2-[(3-phenyl-2-sulfanylpropanoyl)amino]propanediamide |
| SMILES | O=C(NC(C(=O)NCc1ccccc1)C(=O)NCc1ccccc1)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C26H27N3O3S/c30-24(22(33)16-19-10-4-1-5-11-19)29-23(25(31)27-17-20-12-6-2-7-13-20)26(32)28-18-21-14-8-3-9-15-21/h1-15,22-23,33H,16-18H2,(H,27,31)(H,28,32)(H,29,30) |
| InChIKey | LVTOCZNOOPJHQS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|