C26H27AsN2O3S — CID 173255243
N,N'-dibenzyl-2-(3-phenyl-2-sulfanylpropanoyl)arsanylpropanediamide (PubChem CID 173255243) has the molecular formula C26H27AsN2O3S and a molecular weight of 522.50 g/mol. Its IUPAC name is N,N'-dibenzyl-2-(3-phenyl-2-sulfanylpropanoyl)arsanylpropanediamide.
| Compound Name | N,N'-dibenzyl-2-(3-phenyl-2-sulfanylpropanoyl)arsanylpropanediamide |
|---|---|
| PubChem CID | 173255243 |
| Molecular Formula | C26H27AsN2O3S |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | N,N'-dibenzyl-2-(3-phenyl-2-sulfanylpropanoyl)arsanylpropanediamide |
| SMILES | O=C([AsH]C(C(=O)NCc1ccccc1)C(=O)NCc1ccccc1)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C26H27AsN2O3S/c30-24(22(33)16-19-10-4-1-5-11-19)27-23(25(31)28-17-20-12-6-2-7-13-20)26(32)29-18-21-14-8-3-9-15-21/h1-15,22-23,27,33H,16-18H2,(H,28,31)(H,29,32) |
| InChIKey | OVAXOUKUHONPHQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|