C22H27N3O4 — CID 18348128
tert-butyl N-[1,3-bis(benzylamino)-1,3-dioxopropan-2-yl]carbamate (PubChem CID 18348128) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is tert-butyl N-[1,3-bis(benzylamino)-1,3-dioxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1,3-bis(benzylamino)-1,3-dioxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18348128 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | tert-butyl N-[1,3-bis(benzylamino)-1,3-dioxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)NCc1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H27N3O4/c1-22(2,3)29-21(28)25-18(19(26)23-14-16-10-6-4-7-11-16)20(27)24-15-17-12-8-5-9-13-17/h4-13,18H,14-15H2,1-3H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | IYFMAXAHYMHIRF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|