C19H29N3O5 — CID 142973690
tert-butyl N-[1-(benzylamino)-4-(ethoxycarbonylamino)-1-oxobutan-2-yl]carbamate (PubChem CID 142973690) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl N-[1-(benzylamino)-4-(ethoxycarbonylamino)-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(benzylamino)-4-(ethoxycarbonylamino)-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142973690 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | tert-butyl N-[1-(benzylamino)-4-(ethoxycarbonylamino)-1-oxobutan-2-yl]carbamate |
| SMILES | CCOC(=O)NCCC(NC(=O)OC(C)(C)C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H29N3O5/c1-5-26-17(24)20-12-11-15(22-18(25)27-19(2,3)4)16(23)21-13-14-9-7-6-8-10-14/h6-10,15H,5,11-13H2,1-4H3,(H,20,24)(H,21,23)(H,22,25) |
| InChIKey | HWANCVFTHGICDA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |