C23H36N2O3 — CID 10834164
tert-butyl N-[(E,3S)-6-(benzylcarbamoyl)-2,7-dimethyloct-4-en-3-yl]carbamate (PubChem CID 10834164) has the molecular formula C23H36N2O3 and a molecular weight of 388.55 g/mol. Its IUPAC name is tert-butyl N-[(E,3S)-6-(benzylcarbamoyl)-2,7-dimethyloct-4-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(E,3S)-6-(benzylcarbamoyl)-2,7-dimethyloct-4-en-3-yl]carbamate |
|---|---|
| PubChem CID | 10834164 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | tert-butyl N-[(E,3S)-6-(benzylcarbamoyl)-2,7-dimethyloct-4-en-3-yl]carbamate |
| SMILES | CC(C)C(/C=C/[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H36N2O3/c1-16(2)19(21(26)24-15-18-11-9-8-10-12-18)13-14-20(17(3)4)25-22(27)28-23(5,6)7/h8-14,16-17,19-20H,15H2,1-7H3,(H,24,26)(H,25,27)/b14-13+/t19?,20-/m1/s1 |
| InChIKey | OTTKTSJHDKGILD-PPKNFKQDSA-N |
| XLogP | 4.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|