C29H39N3O4 — CID 70204291
tert-butyl (2S,3R)-2-[(E)-1-(benzylamino)-1-oxo-4-phenylbut-3-en-2-yl]-3-(hydrazinecarbonyl)-5-methylhexanoate (PubChem CID 70204291) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[(E)-1-(benzylamino)-1-oxo-4-phenylbut-3-en-2-yl]-3-(hydrazinecarbonyl)-5-methylhexanoate.
| Compound Name | tert-butyl (2S,3R)-2-[(E)-1-(benzylamino)-1-oxo-4-phenylbut-3-en-2-yl]-3-(hydrazinecarbonyl)-5-methylhexanoate |
|---|---|
| PubChem CID | 70204291 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | tert-butyl (2S,3R)-2-[(E)-1-(benzylamino)-1-oxo-4-phenylbut-3-en-2-yl]-3-(hydrazinecarbonyl)-5-methylhexanoate |
| SMILES | CC(C)C[C@@H](C(=O)NN)[C@H](C(=O)OC(C)(C)C)C(/C=C/c1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H39N3O4/c1-20(2)18-24(27(34)32-30)25(28(35)36-29(3,4)5)23(17-16-21-12-8-6-9-13-21)26(33)31-19-22-14-10-7-11-15-22/h6-17,20,23-25H,18-19,30H2,1-5H3,(H,31,33)(H,32,34)/b17-16+/t23?,24-,25-/m1/s1 |
| InChIKey | SYBPSAWQRFMZHQ-YLTSJIEASA-N |
| XLogP | 4.24 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|