C25H25NO — CID 164898987
(E,2S,3S)-N-benzyl-3-methyl-2,5-diphenylpent-4-enamide (PubChem CID 164898987) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is (E,2S,3S)-N-benzyl-3-methyl-2,5-diphenylpent-4-enamide.
| Compound Name | (E,2S,3S)-N-benzyl-3-methyl-2,5-diphenylpent-4-enamide |
|---|---|
| PubChem CID | 164898987 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (E,2S,3S)-N-benzyl-3-methyl-2,5-diphenylpent-4-enamide |
| SMILES | C[C@@H](/C=C/c1ccccc1)[C@H](C(=O)NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO/c1-20(17-18-21-11-5-2-6-12-21)24(23-15-9-4-10-16-23)25(27)26-19-22-13-7-3-8-14-22/h2-18,20,24H,19H2,1H3,(H,26,27)/b18-17+/t20-,24-/m0/s1 |
| InChIKey | UYYGUASRZQRHIK-BZYKCZEQSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |