C25H25NOS — CID 164898997
(E,2R,3S)-N-benzyl-3-methyl-5-phenyl-2-phenylsulfanylpent-4-enamide (PubChem CID 164898997) has the molecular formula C25H25NOS and a molecular weight of 387.55 g/mol. Its IUPAC name is (E,2R,3S)-N-benzyl-3-methyl-5-phenyl-2-phenylsulfanylpent-4-enamide.
| Compound Name | (E,2R,3S)-N-benzyl-3-methyl-5-phenyl-2-phenylsulfanylpent-4-enamide |
|---|---|
| PubChem CID | 164898997 |
| Molecular Formula | C25H25NOS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (E,2R,3S)-N-benzyl-3-methyl-5-phenyl-2-phenylsulfanylpent-4-enamide |
| SMILES | C[C@@H](/C=C/c1ccccc1)[C@@H](Sc1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H25NOS/c1-20(17-18-21-11-5-2-6-12-21)24(28-23-15-9-4-10-16-23)25(27)26-19-22-13-7-3-8-14-22/h2-18,20,24H,19H2,1H3,(H,26,27)/b18-17+/t20-,24+/m0/s1 |
| InChIKey | BOZFTIIVFIXZCY-WTYGBKJTSA-N |
| XLogP | 5.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |