C21H19NOS — CID 1371457
(2S)-N-benzyl-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 1371457) has the molecular formula C21H19NOS and a molecular weight of 333.46 g/mol. Its IUPAC name is (2S)-N-benzyl-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | (2S)-N-benzyl-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 1371457 |
| Molecular Formula | C21H19NOS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2S)-N-benzyl-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(NCc1ccccc1)[C@@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19NOS/c23-21(22-16-17-10-4-1-5-11-17)20(18-12-6-2-7-13-18)24-19-14-8-3-9-15-19/h1-15,20H,16H2,(H,22,23)/t20-/m0/s1 |
| InChIKey | KSRSMDNYJFNTHG-FQEVSTJZSA-N |
| XLogP | 4.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |