C16H15N5OS — CID 124506736
(2S)-N-benzyl-2-phenyl-2-(2H-tetrazol-5-ylsulfanyl)acetamide (PubChem CID 124506736) has the molecular formula C16H15N5OS and a molecular weight of 325.40 g/mol. Its IUPAC name is (2S)-N-benzyl-2-phenyl-2-(2H-tetrazol-5-ylsulfanyl)acetamide.
| Compound Name | (2S)-N-benzyl-2-phenyl-2-(2H-tetrazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 124506736 |
| Molecular Formula | C16H15N5OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (2S)-N-benzyl-2-phenyl-2-(2H-tetrazol-5-ylsulfanyl)acetamide |
| SMILES | O=C(NCc1ccccc1)[C@@H](Sc1nn[nH]n1)c1ccccc1 |
| InChI | InChI=1S/C16H15N5OS/c22-15(17-11-12-7-3-1-4-8-12)14(13-9-5-2-6-10-13)23-16-18-20-21-19-16/h1-10,14H,11H2,(H,17,22)(H,18,19,20,21)/t14-/m0/s1 |
| InChIKey | IWAVOKRVFJDGKR-AWEZNQCLSA-N |
| XLogP | 2.35 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |