C21H20N2O3S2 — CID 2904729
2-phenyl-2-phenylsulfanyl-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 2904729) has the molecular formula C21H20N2O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 2-phenyl-2-phenylsulfanyl-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-phenyl-2-phenylsulfanyl-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 2904729 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-phenyl-2-phenylsulfanyl-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C(Sc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O3S2/c22-28(25,26)19-13-11-16(12-14-19)15-23-21(24)20(17-7-3-1-4-8-17)27-18-9-5-2-6-10-18/h1-14,20H,15H2,(H,23,24)(H2,22,25,26) |
| InChIKey | COKYERIVQANYFV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |