C22H18F3NO2S — CID 26207800
(2S)-2-phenyl-2-phenylsulfanyl-N-[[4-(trifluoromethoxy)phenyl]methyl]acetamide (PubChem CID 26207800) has the molecular formula C22H18F3NO2S and a molecular weight of 417.45 g/mol. Its IUPAC name is (2S)-2-phenyl-2-phenylsulfanyl-N-[[4-(trifluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | (2S)-2-phenyl-2-phenylsulfanyl-N-[[4-(trifluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 26207800 |
| Molecular Formula | C22H18F3NO2S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (2S)-2-phenyl-2-phenylsulfanyl-N-[[4-(trifluoromethoxy)phenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)cc1)[C@@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18F3NO2S/c23-22(24,25)28-18-13-11-16(12-14-18)15-26-21(27)20(17-7-3-1-4-8-17)29-19-9-5-2-6-10-19/h1-14,20H,15H2,(H,26,27)/t20-/m0/s1 |
| InChIKey | GDTMLCAJFDLOEC-FQEVSTJZSA-N |
| XLogP | 5.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |