C22H19NO3S — CID 2904025
N-(1,3-benzodioxol-5-ylmethyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 2904025) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 2904025 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO3S/c24-22(23-14-16-11-12-19-20(13-16)26-15-25-19)21(17-7-3-1-4-8-17)27-18-9-5-2-6-10-18/h1-13,21H,14-15H2,(H,23,24) |
| InChIKey | YTKNXPZKJBWGIC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |