C23H20ClNO3S — CID 2365823
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate (PubChem CID 2365823) has the molecular formula C23H20ClNO3S and a molecular weight of 425.94 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate.
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 2365823 |
| Molecular Formula | C23H20ClNO3S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate |
| SMILES | O=C(COC(=O)[C@@H](Sc1ccccc1)c1ccccc1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClNO3S/c24-19-13-11-17(12-14-19)15-25-21(26)16-28-23(27)22(18-7-3-1-4-8-18)29-20-9-5-2-6-10-20/h1-14,22H,15-16H2,(H,25,26)/t22-/m0/s1 |
| InChIKey | GIPRISLNGWPEOM-QFIPXVFZSA-N |
| XLogP | 5.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |