C22H20ClN3OS2 — CID 2956706
1-[(4-chlorophenyl)methyl]-3-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiourea (PubChem CID 2956706) has the molecular formula C22H20ClN3OS2 and a molecular weight of 442.01 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiourea |
|---|---|
| PubChem CID | 2956706 |
| Molecular Formula | C22H20ClN3OS2 |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiourea |
| SMILES | O=C(NNC(=S)NCc1ccc(Cl)cc1)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20ClN3OS2/c23-18-13-11-16(12-14-18)15-24-22(28)26-25-21(27)20(17-7-3-1-4-8-17)29-19-9-5-2-6-10-19/h1-14,20H,15H2,(H,25,27)(H2,24,26,28) |
| InChIKey | KKZSXIBNEHGRPW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|