C28H24N2O2S — CID 3596364
N-benzyl-2-[(2-phenyl-2-phenylsulfanylacetyl)amino]benzamide (PubChem CID 3596364) has the molecular formula C28H24N2O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-benzyl-2-[(2-phenyl-2-phenylsulfanylacetyl)amino]benzamide.
| Compound Name | N-benzyl-2-[(2-phenyl-2-phenylsulfanylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 3596364 |
| Molecular Formula | C28H24N2O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-benzyl-2-[(2-phenyl-2-phenylsulfanylacetyl)amino]benzamide |
| SMILES | O=C(NCc1ccccc1)c1ccccc1NC(=O)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24N2O2S/c31-27(29-20-21-12-4-1-5-13-21)24-18-10-11-19-25(24)30-28(32)26(22-14-6-2-7-15-22)33-23-16-8-3-9-17-23/h1-19,26H,20H2,(H,29,31)(H,30,32) |
| InChIKey | DLZZDRHYZMUHDS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |