C19H23N3O2S2 — CID 2956623
1-(3-methoxypropyl)-3-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiourea (PubChem CID 2956623) has the molecular formula C19H23N3O2S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiourea |
|---|---|
| PubChem CID | 2956623 |
| Molecular Formula | C19H23N3O2S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiourea |
| SMILES | COCCCNC(=S)NNC(=O)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O2S2/c1-24-14-8-13-20-19(25)22-21-18(23)17(15-9-4-2-5-10-15)26-16-11-6-3-7-12-16/h2-7,9-12,17H,8,13-14H2,1H3,(H,21,23)(H2,20,22,25) |
| InChIKey | GWWJNTTUGKIIFO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|