C19H21NO3S — CID 119234592
5-[(2-phenyl-2-phenylsulfanylacetyl)amino]pentanoic acid (PubChem CID 119234592) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 5-[(2-phenyl-2-phenylsulfanylacetyl)amino]pentanoic acid.
| Compound Name | 5-[(2-phenyl-2-phenylsulfanylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119234592 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 5-[(2-phenyl-2-phenylsulfanylacetyl)amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO3S/c21-17(22)13-7-8-14-20-19(23)18(15-9-3-1-4-10-15)24-16-11-5-2-6-12-16/h1-6,9-12,18H,7-8,13-14H2,(H,20,23)(H,21,22) |
| InChIKey | XHEJNZZLZHEGDB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|