C19H22N2O2S — CID 39964892
(2R)-N-ethyl-2-[[(2R)-2-phenyl-2-phenylsulfanylacetyl]amino]propanamide (PubChem CID 39964892) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is (2R)-N-ethyl-2-[[(2R)-2-phenyl-2-phenylsulfanylacetyl]amino]propanamide.
| Compound Name | (2R)-N-ethyl-2-[[(2R)-2-phenyl-2-phenylsulfanylacetyl]amino]propanamide |
|---|---|
| PubChem CID | 39964892 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (2R)-N-ethyl-2-[[(2R)-2-phenyl-2-phenylsulfanylacetyl]amino]propanamide |
| SMILES | CCNC(=O)[C@@H](C)NC(=O)[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O2S/c1-3-20-18(22)14(2)21-19(23)17(15-10-6-4-7-11-15)24-16-12-8-5-9-13-16/h4-14,17H,3H2,1-2H3,(H,20,22)(H,21,23)/t14-,17-/m1/s1 |
| InChIKey | KLJPIPJZBZQPAS-RHSMWYFYSA-N |
| XLogP | 3.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |