C22H29NOS — CID 2914171
N-(6-methylheptan-2-yl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 2914171) has the molecular formula C22H29NOS and a molecular weight of 355.55 g/mol. Its IUPAC name is N-(6-methylheptan-2-yl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-(6-methylheptan-2-yl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 2914171 |
| Molecular Formula | C22H29NOS |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-(6-methylheptan-2-yl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | CC(C)CCCC(C)NC(=O)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29NOS/c1-17(2)11-10-12-18(3)23-22(24)21(19-13-6-4-7-14-19)25-20-15-8-5-9-16-20/h4-9,13-18,21H,10-12H2,1-3H3,(H,23,24) |
| InChIKey | HXWPYCIMJMUQQY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |