C22H29NOS — CID 5102974
N,N-bis(2-methylpropyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 5102974) has the molecular formula C22H29NOS and a molecular weight of 355.55 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N,N-bis(2-methylpropyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 5102974 |
| Molecular Formula | C22H29NOS |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N,N-bis(2-methylpropyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29NOS/c1-17(2)15-23(16-18(3)4)22(24)21(19-11-7-5-8-12-19)25-20-13-9-6-10-14-20/h5-14,17-18,21H,15-16H2,1-4H3 |
| InChIKey | LZLWMZPQFJRGGQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |