C22H21NOS — CID 884563
(2R)-N-ethyl-N,2-diphenyl-2-phenylsulfanylacetamide (PubChem CID 884563) has the molecular formula C22H21NOS and a molecular weight of 347.48 g/mol. Its IUPAC name is (2R)-N-ethyl-N,2-diphenyl-2-phenylsulfanylacetamide.
| Compound Name | (2R)-N-ethyl-N,2-diphenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 884563 |
| Molecular Formula | C22H21NOS |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (2R)-N-ethyl-N,2-diphenyl-2-phenylsulfanylacetamide |
| SMILES | CCN(C(=O)[C@H](Sc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NOS/c1-2-23(19-14-8-4-9-15-19)22(24)21(18-12-6-3-7-13-18)25-20-16-10-5-11-17-20/h3-17,21H,2H2,1H3/t21-/m1/s1 |
| InChIKey | PTCSFJWTRUMHCU-OAQYLSRUSA-N |
| XLogP | 5.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |