C20H25NOS — CID 3702485
2-phenyl-2-phenylsulfanyl-N,N-dipropylacetamide (PubChem CID 3702485) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is 2-phenyl-2-phenylsulfanyl-N,N-dipropylacetamide.
| Compound Name | 2-phenyl-2-phenylsulfanyl-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 3702485 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-phenyl-2-phenylsulfanyl-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NOS/c1-3-15-21(16-4-2)20(22)19(17-11-7-5-8-12-17)23-18-13-9-6-10-14-18/h5-14,19H,3-4,15-16H2,1-2H3 |
| InChIKey | HWAAQIPBOVLUCP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |