C11H15NO3 — CID 11195148
N-ethyl-2,3-dihydroxy-N-phenylpropanamide (PubChem CID 11195148) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-ethyl-2,3-dihydroxy-N-phenylpropanamide.
| Compound Name | N-ethyl-2,3-dihydroxy-N-phenylpropanamide |
|---|---|
| PubChem CID | 11195148 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-ethyl-2,3-dihydroxy-N-phenylpropanamide |
| SMILES | CCN(C(=O)C(O)CO)c1ccccc1 |
| InChI | InChI=1S/C11H15NO3/c1-2-12(11(15)10(14)8-13)9-6-4-3-5-7-9/h3-7,10,13-14H,2,8H2,1H3 |
| InChIKey | BIKFCMWSKLWHGA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |