C16H25NOS — CID 112795259
N,N-diethyl-2-(2-methylpropylsulfanyl)-2-phenylacetamide (PubChem CID 112795259) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is N,N-diethyl-2-(2-methylpropylsulfanyl)-2-phenylacetamide.
| Compound Name | N,N-diethyl-2-(2-methylpropylsulfanyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 112795259 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N,N-diethyl-2-(2-methylpropylsulfanyl)-2-phenylacetamide |
| SMILES | CCN(CC)C(=O)C(SCC(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H25NOS/c1-5-17(6-2)16(18)15(19-12-13(3)4)14-10-8-7-9-11-14/h7-11,13,15H,5-6,12H2,1-4H3 |
| InChIKey | HZPARFQRKGHDSY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |