C22H21NO3S — CID 4043890
N-[2-(3,4-dihydroxyphenyl)ethyl]-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 4043890) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 4043890 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO3S/c24-19-12-11-16(15-20(19)25)13-14-23-22(26)21(17-7-3-1-4-8-17)27-18-9-5-2-6-10-18/h1-12,15,21,24-25H,13-14H2,(H,23,26) |
| InChIKey | PLJVVCVVLJRJAE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|