C25H22N2OS — CID 40798749
(2S)-2-phenyl-2-phenylsulfanyl-N-(2-quinolin-8-ylethyl)acetamide (PubChem CID 40798749) has the molecular formula C25H22N2OS and a molecular weight of 398.53 g/mol. Its IUPAC name is (2S)-2-phenyl-2-phenylsulfanyl-N-(2-quinolin-8-ylethyl)acetamide.
| Compound Name | (2S)-2-phenyl-2-phenylsulfanyl-N-(2-quinolin-8-ylethyl)acetamide |
|---|---|
| PubChem CID | 40798749 |
| Molecular Formula | C25H22N2OS |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (2S)-2-phenyl-2-phenylsulfanyl-N-(2-quinolin-8-ylethyl)acetamide |
| SMILES | O=C(NCCc1cccc2cccnc12)[C@@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2OS/c28-25(27-18-16-20-12-7-11-19-13-8-17-26-23(19)20)24(21-9-3-1-4-10-21)29-22-14-5-2-6-15-22/h1-15,17,24H,16,18H2,(H,27,28)/t24-/m0/s1 |
| InChIKey | YRWWGMWYSUASQL-DEOSSOPVSA-N |
| XLogP | 5.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |