C19H18N4O2S — CID 135950983
(2R)-2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-benzyl-2-phenylacetamide (PubChem CID 135950983) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is (2R)-2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-benzyl-2-phenylacetamide.
| Compound Name | (2R)-2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-benzyl-2-phenylacetamide |
|---|---|
| PubChem CID | 135950983 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2R)-2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-benzyl-2-phenylacetamide |
| SMILES | Nc1cc(=O)[nH]c(S[C@@H](C(=O)NCc2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C19H18N4O2S/c20-15-11-16(24)23-19(22-15)26-17(14-9-5-2-6-10-14)18(25)21-12-13-7-3-1-4-8-13/h1-11,17H,12H2,(H,21,25)(H3,20,22,23,24)/t17-/m1/s1 |
| InChIKey | HIYZHWIKZDIRTG-QGZVFWFLSA-N |
| XLogP | 2.50 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |