C34H42N2O5S — CID 86756728
tert-butyl (2S,3R)-3-[(N-benzylsulfonylanilino)carbamoyl]-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanoate (PubChem CID 86756728) has the molecular formula C34H42N2O5S and a molecular weight of 590.79 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[(N-benzylsulfonylanilino)carbamoyl]-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanoate.
| Compound Name | tert-butyl (2S,3R)-3-[(N-benzylsulfonylanilino)carbamoyl]-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanoate |
|---|---|
| PubChem CID | 86756728 |
| Molecular Formula | C34H42N2O5S |
| Molecular Weight | 590.79 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | tert-butyl (2S,3R)-3-[(N-benzylsulfonylanilino)carbamoyl]-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanoate |
| SMILES | CC(C)CC(C(=O)NN(c1ccccc1)S(=O)(=O)Cc1ccccc1)[C@H](C/C=C/c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H42N2O5S/c1-26(2)24-31(30(33(38)41-34(3,4)5)23-15-20-27-16-9-6-10-17-27)32(37)35-36(29-21-13-8-14-22-29)42(39,40)25-28-18-11-7-12-19-28/h6-22,26,30-31H,23-25H2,1-5H3,(H,35,37)/b20-15+/t30-,31?/m0/s1 |
| InChIKey | ZYIIHNIQNXHRCV-OYXDBKOBSA-N |
| XLogP | 6.78 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.79 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|