C23H37N5O4 — CID 70238670
tert-butyl (2S,3R)-3-[[[amino(methyl)amino]carbamoylamino]carbamoyl]-5-methyl-2-(3-phenylprop-2-enyl)hexanoate (PubChem CID 70238670) has the molecular formula C23H37N5O4 and a molecular weight of 447.58 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[[[amino(methyl)amino]carbamoylamino]carbamoyl]-5-methyl-2-(3-phenylprop-2-enyl)hexanoate.
| Compound Name | tert-butyl (2S,3R)-3-[[[amino(methyl)amino]carbamoylamino]carbamoyl]-5-methyl-2-(3-phenylprop-2-enyl)hexanoate |
|---|---|
| PubChem CID | 70238670 |
| Molecular Formula | C23H37N5O4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | tert-butyl (2S,3R)-3-[[[amino(methyl)amino]carbamoylamino]carbamoyl]-5-methyl-2-(3-phenylprop-2-enyl)hexanoate |
| SMILES | CC(C)C[C@@H](C(=O)NNC(=O)NN(C)N)[C@H](CC=Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37N5O4/c1-16(2)15-19(20(29)25-26-22(31)27-28(6)24)18(21(30)32-23(3,4)5)14-10-13-17-11-8-7-9-12-17/h7-13,16,18-19H,14-15,24H2,1-6H3,(H,25,29)(H2,26,27,31)/t18-,19+/m0/s1 |
| InChIKey | WZZQOGHCUYGNSE-RBUKOAKNSA-N |
| XLogP | 2.76 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|