C25H38N4O5 — CID 139917369
(2S,3R)-3-[[[(2R)-2-aminopropanoyl]amino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-[(E)-3-phenylprop-2-enyl]hexanamide (PubChem CID 139917369) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is (2S,3R)-3-[[[(2R)-2-aminopropanoyl]amino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-[(E)-3-phenylprop-2-enyl]hexanamide.
| Compound Name | (2S,3R)-3-[[[(2R)-2-aminopropanoyl]amino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-[(E)-3-phenylprop-2-enyl]hexanamide |
|---|---|
| PubChem CID | 139917369 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (2S,3R)-3-[[[(2R)-2-aminopropanoyl]amino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-[(E)-3-phenylprop-2-enyl]hexanamide |
| SMILES | CC(C)C[C@@H](C(=O)NNC(=O)[C@@H](C)N)[C@H](C/C=C/c1ccccc1)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C25H38N4O5/c1-17(2)16-21(24(31)28-27-23(30)18(3)26)20(13-9-12-19-10-5-4-6-11-19)25(32)29-34-22-14-7-8-15-33-22/h4-6,9-12,17-18,20-22H,7-8,13-16,26H2,1-3H3,(H,27,30)(H,28,31)(H,29,32)/b12-9+/t18-,20+,21-,22?/m1/s1 |
| InChIKey | CUXBEZUWMHMVDD-SUTLHVSASA-N |
| XLogP | 2.44 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|