C32H43N3O6S — CID 173231835
(2S,3R)-5-methyl-3-[[methylsulfonyl(3-phenylprop-2-enyl)amino]carbamoyl]-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide (PubChem CID 173231835) has the molecular formula C32H43N3O6S and a molecular weight of 597.78 g/mol. Its IUPAC name is (2S,3R)-5-methyl-3-[[methylsulfonyl(3-phenylprop-2-enyl)amino]carbamoyl]-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide.
| Compound Name | (2S,3R)-5-methyl-3-[[methylsulfonyl(3-phenylprop-2-enyl)amino]carbamoyl]-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 173231835 |
| Molecular Formula | C32H43N3O6S |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | (2S,3R)-5-methyl-3-[[methylsulfonyl(3-phenylprop-2-enyl)amino]carbamoyl]-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide |
| SMILES | CC(C)CC(C(=O)NN(CC=Cc1ccccc1)S(C)(=O)=O)[C@H](CC=Cc1ccccc1)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C32H43N3O6S/c1-25(2)24-29(31(36)33-35(42(3,38)39)22-13-19-27-16-8-5-9-17-27)28(20-12-18-26-14-6-4-7-15-26)32(37)34-41-30-21-10-11-23-40-30/h4-9,12-19,25,28-30H,10-11,20-24H2,1-3H3,(H,33,36)(H,34,37)/t28-,29?,30?/m0/s1 |
| InChIKey | LQRSPDJABMDKGH-ZMTVJDMPSA-N |
| XLogP | 4.95 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|