C22H33N3O4 — CID 154163621
(2S,3R)-3-(hydrazinecarbonyl)-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide (PubChem CID 154163621) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is (2S,3R)-3-(hydrazinecarbonyl)-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide.
| Compound Name | (2S,3R)-3-(hydrazinecarbonyl)-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 154163621 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (2S,3R)-3-(hydrazinecarbonyl)-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide |
| SMILES | CC(C)CC(C(=O)NN)[C@H](CC=Cc1ccccc1)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C22H33N3O4/c1-16(2)15-19(21(26)24-23)18(12-8-11-17-9-4-3-5-10-17)22(27)25-29-20-13-6-7-14-28-20/h3-5,8-11,16,18-20H,6-7,12-15,23H2,1-2H3,(H,24,26)(H,25,27)/t18-,19?,20?/m0/s1 |
| InChIKey | MFUGATOWZQGTPV-HDYDNRTBSA-N |
| XLogP | 2.93 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|