C35H52N4O8S — CID 173233139
(2S,3R)-3-[[[(2R)-2-aminopropanoyl]-propylamino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide;4-methylbenzenesulfonic acid (PubChem CID 173233139) has the molecular formula C35H52N4O8S and a molecular weight of 688.89 g/mol. Its IUPAC name is (2S,3R)-3-[[[(2R)-2-aminopropanoyl]-propylamino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide;4-methylbenzenesulfonic acid.
| Compound Name | (2S,3R)-3-[[[(2R)-2-aminopropanoyl]-propylamino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173233139 |
| Molecular Formula | C35H52N4O8S |
| Molecular Weight | 688.89 g/mol |
| Exact Mass | 688.35 |
| IUPAC Name | (2S,3R)-3-[[[(2R)-2-aminopropanoyl]-propylamino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide;4-methylbenzenesulfonic acid |
| SMILES | CCCN(NC(=O)[C@H](CC(C)C)[C@H](CC=Cc1ccccc1)C(=O)NOC1CCCCO1)C(=O)[C@@H](C)N.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H44N4O5.C7H8O3S/c1-5-17-32(28(35)21(4)29)30-26(33)24(19-20(2)3)23(15-11-14-22-12-7-6-8-13-22)27(34)31-37-25-16-9-10-18-36-25;1-6-2-4-7(5-3-6)11(8,9)10/h6-8,11-14,20-21,23-25H,5,9-10,15-19,29H2,1-4H3,(H,30,33)(H,31,34);2-5H,1H3,(H,8,9,10)/t21-,23+,24-,25?;/m1./s1 |
| InChIKey | OZRUCGHHZLIOEV-BLJRIZNGSA-N |
| XLogP | 4.80 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.89 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|