C32H48N4O8S — CID 173233290
(2S,3R)-3-[[[(2R)-2-aminopropanoyl]-(3-hydroxy-2,2-dimethylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide;4-methylbenzenesulfonic acid (PubChem CID 173233290) has the molecular formula C32H48N4O8S and a molecular weight of 648.82 g/mol. Its IUPAC name is (2S,3R)-3-[[[(2R)-2-aminopropanoyl]-(3-hydroxy-2,2-dimethylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide;4-methylbenzenesulfonic acid.
| Compound Name | (2S,3R)-3-[[[(2R)-2-aminopropanoyl]-(3-hydroxy-2,2-dimethylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173233290 |
| Molecular Formula | C32H48N4O8S |
| Molecular Weight | 648.82 g/mol |
| Exact Mass | 648.32 |
| IUPAC Name | (2S,3R)-3-[[[(2R)-2-aminopropanoyl]-(3-hydroxy-2,2-dimethylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide;4-methylbenzenesulfonic acid |
| SMILES | CC(C)C[C@@H](C(=O)NN(CC(C)(C)CO)C(=O)[C@@H](C)N)[C@H](CC=Cc1ccccc1)C(=O)NO.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C25H40N4O5.C7H8O3S/c1-17(2)14-21(20(23(32)28-34)13-9-12-19-10-7-6-8-11-19)22(31)27-29(24(33)18(3)26)15-25(4,5)16-30;1-6-2-4-7(5-3-6)11(8,9)10/h6-12,17-18,20-21,30,34H,13-16,26H2,1-5H3,(H,27,31)(H,28,32);2-5H,1H3,(H,8,9,10)/t18-,20+,21-;/m1./s1 |
| InChIKey | RZHODQUHFYMJHG-XUYZFQGESA-N |
| XLogP | 3.34 |
| TPSA | 199.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.82 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|