C22H33N3O5S — CID 173231639
(2S,3R)-3-[[cyclopropylmethyl(methylsulfonyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide (PubChem CID 173231639) has the molecular formula C22H33N3O5S and a molecular weight of 451.59 g/mol. Its IUPAC name is (2S,3R)-3-[[cyclopropylmethyl(methylsulfonyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide.
| Compound Name | (2S,3R)-3-[[cyclopropylmethyl(methylsulfonyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 173231639 |
| Molecular Formula | C22H33N3O5S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (2S,3R)-3-[[cyclopropylmethyl(methylsulfonyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide |
| SMILES | CC(C)C[C@@H](C(=O)NN(CC1CC1)S(C)(=O)=O)[C@H](CC=Cc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C22H33N3O5S/c1-16(2)14-20(21(26)23-25(31(3,29)30)15-18-12-13-18)19(22(27)24-28)11-7-10-17-8-5-4-6-9-17/h4-10,16,18-20,28H,11-15H2,1-3H3,(H,23,26)(H,24,27)/t19-,20+/m0/s1 |
| InChIKey | NPKLHDFJDSXIIO-VQTJNVASSA-N |
| XLogP | 2.58 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|