C25H31Cl2N3O5S — CID 173231807
(2S,3R)-3-[[(2,6-dichlorophenyl)methyl-methylsulfonylamino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide (PubChem CID 173231807) has the molecular formula C25H31Cl2N3O5S and a molecular weight of 556.51 g/mol. Its IUPAC name is (2S,3R)-3-[[(2,6-dichlorophenyl)methyl-methylsulfonylamino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide.
| Compound Name | (2S,3R)-3-[[(2,6-dichlorophenyl)methyl-methylsulfonylamino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 173231807 |
| Molecular Formula | C25H31Cl2N3O5S |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | (2S,3R)-3-[[(2,6-dichlorophenyl)methyl-methylsulfonylamino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide |
| SMILES | CC(C)C[C@@H](C(=O)NN(Cc1c(Cl)cccc1Cl)S(C)(=O)=O)[C@H](CC=Cc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C25H31Cl2N3O5S/c1-17(2)15-20(19(25(32)29-33)12-7-11-18-9-5-4-6-10-18)24(31)28-30(36(3,34)35)16-21-22(26)13-8-14-23(21)27/h4-11,13-14,17,19-20,33H,12,15-16H2,1-3H3,(H,28,31)(H,29,32)/t19-,20+/m0/s1 |
| InChIKey | FISTYEREPKMUSF-VQTJNVASSA-N |
| XLogP | 4.67 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|